Hotplate Accessories
eMolecules 1779-48-2 | PHENYLPHOSPHINIC ACID | AstaTech | MFCD00002131 | 142.094 | C6H7O2P | 95.000 | OP(=O)c1ccccc1 | 5g | 718059919
PHENYLPHOSPHINIC ACID | AstaTech | 1779-48-2 | MFCD00002131 | 142.094 | C6H7O2P | 95.000 | OP(=O)c1ccccc1 | 5g | 718059919
eMolecules 862728-59-4 | Ambeed | 2-Cyclopropoxyethyl 4-methylbenzenesulfonate | 250mg | 601097257 | A391476 | MFCD22209886 | 256.32 | C12H16O4S
Ambeed | 2-Cyclopropoxyethyl 4-methylbenzenesulfonate | 250mg | 601097257 | A391476 | 862728-59-4 | MFCD22209886 | 256.320 | C12H16O4S
eMolecules 1314538-55-0 | ChemScene | Potassium (((tert-butoxycarbonyl)amino)methyl)trifluoroborate | 250mg | 536849527 | CS-W006460 | MFCD19686142 | 237.07 | C6H12BF3KNO2
ChemScene | cis-Dichlorobis(triphenylphosphine)platinum(II) | 1g | 572185652 | CS-0085661 | 15604-36-1 | 790.570 | C36H30Cl2P2Pt
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 37795-77-0 | 6-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione | Ambeed | MFCD02179411 | 193.158 | C9H7NO4 | 97.000 | COc1ccc2[nH]c(=O)oc(=O)c2c1 | 250mg | 521391988](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502429527.PNG-250.jpg)
eMolecules 37795-77-0 | 6-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione | Ambeed | MFCD02179411 | 193.158 | C9H7NO4 | 97.000 | COc1ccc2[nH]c(=O)oc(=O)c2c1 | 250mg | 521391988
6-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione | Ambeed | 37795-77-0 | MFCD02179411 | 193.158 | C9H7NO4 | 97.000 | COc1ccc2[nH]c(=O)oc(=O)c2c1 | 250mg | 521391988
eMolecules 23377-40-4 | Ambeed | 3-(Hexadecyloxy)propan-1-ol | 250mg | 525100017 | A182606 | MFCD00171483 | 300.527 | C19H40O2
ChemScene | 3-Morpholino-56-dihydropyridin-2(1H)-one | 100mg | 536795771 | CS-0063174 | 545445-40-7 | MFCD18072442 | 182.223 | C9H14N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 19264-73-4 | Ambeed | 9-(p-Tolyl)-9H-carbazole | 250mg | 628567600 | A447114 | MFCD14708175 | 257.336 | C19H15N
Ambeed | 6-Nitronaphthalen-2-amine | 250mg | 552666117 | A234672 | 3230-35-1 | MFCD00046485 | 188.186 | C10H8N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 2096335-47-4 | Ambeed | 2-(6-Butoxynaphthalen-2-yl)-4455-tetramethyl-132-dioxaborolane | 250mg | 728126529 | A759406 | MFCD16294497 | 326.24 | C20H27BO3
Ambeed | 7-Bromo-4-chloro-2-methylquinazoline | 250mg | 600832531 | A178359 | 403850-84-0 | MFCD09746300 | 257.520 | C9H6BrClN2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules Broadpharm / 2-[(4-[Bis-(2-tert-butoxycarbonylamino-ethyl)-amino]-methyl-benzyl)-(2-tert-butoxycarbonylamino-ethyl)-amino]-ethyl-carbamic acid tert-butyl ester / 100mg / 263744682 / BP-22351 / 96.000 / 1807521-06-7 / MFCD28142457 / 708.942 / C36H64N6O8](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502477656.JPG-250.jpg)
eMolecules Broadpharm / 2-[(4-[Bis-(2-tert-butoxycarbonylamino-ethyl)-amino]-methyl-benzyl)-(2-tert-butoxycarbonylamino-ethyl)-amino]-ethyl-carbamic acid tert-butyl ester / 100mg / 263744682 / BP-22351 / 96.000 / 1807521-06-7 / MFCD28142457 / 708.942 / C36H64N6O8
Broadpharm / 2-[(4-[Bis-(2-tert-butoxycarbonylamino-ethyl)-amino]-methyl-benzyl)-(2-tert-butoxycarbonylamino-ethyl)-amino]-ethyl-carbamic acid tert-butyl ester / 100mg / 263744682 / BP-22351 / 96.000 / 1807521-06-7 / MFCD28142457 / 708.942 / C36H64N6O8
eMolecules 1980783-91-2 | benzyl 2-(benzyloxy)-4-bromo-5-fluorobenzoate | Synthonix415.258 | C21H16BrFO3 | 98.000 | Fc1cc(C(=O)OCc2ccccc2)c(OCc2ccccc2)cc1Br | 250mg | 794076190
benzyl 2-(benzyloxy)-4-bromo-5-fluorobenzoate | Synthonix | 1980783-91-2415.258 | C21H16BrFO3 | 98.000 | Fc1cc(C(=O)OCc2ccccc2)c(OCc2ccccc2)cc1Br | 250mg | 794076190
eMolecules nonyl 7-bromoheptanoate | Broadpharm |335.326 | C16H31BrO2 | 98.000 | CCCCCCCCCOC(=O)CCCCCCBr | 500mg | 779524447
nonyl 7-bromoheptanoate | Broadpharm |335.326 | C16H31BrO2 | 98.000 | CCCCCCCCCOC(=O)CCCCCCBr | 500mg | 779524447
eMolecules 1886972-98-0 | N-(5-Bromo-6-methyl-pyridin-3-yl)-2-trifluoromethyl-isonicotinamide | J&W PharmLab LLC360.134 | C13H9BrF3N3O | 96.000 | Cc1ncc(NC(=O)c2ccnc(c2)C(F)(F)F)cc1Br | 50mg | 746318672
N-(5-Bromo-6-methyl-pyridin-3-yl)-2-trifluoromethyl-isonicotinamide | J&W PharmLab LLC | 1886972-98-0360.134 | C13H9BrF3N3O | 96.000 | Cc1ncc(NC(=O)c2ccnc(c2)C(F)(F)F)cc1Br | 50mg | 746318672
eMolecules 581-42-0 | Ambeed | 26-Dimethylnaphthalene | 250mg | 600852044 | A322385 | MFCD00004120 | 156.228 | C12H12
Ambeed | 26-Dimethylnaphthalene | 250mg | 600852044 | A322385 | 581-42-0 | MFCD00004120 | 156.228 | C12H12
eMolecules 1630-79-1 | Ambeed | Tetrakis(dimethylamino)diboron | 5g | 595929385 | A725016 | MFCD00048012 | 197.93 | C8H24B2N4
Ambeed | (34-Diaminophenyl)dimethylphosphine oxide | 100mg | 660580676 | A1320922 | 2305255-12-1 | 184.179 | C8H13N2OP
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 690632-30-5 | 4-(2-METHOXYPHENOXY)BENZENESULFONYL CHLORIDE | AstaTech | MFCD01631898 | 298.740 | C13H11ClO4S | 95.000 | COc1ccccc1Oc1ccc(cc1)S(Cl)(=O)=O | 5g | 112531343
4-(2-METHOXYPHENOXY)BENZENESULFONYL CHLORIDE | AstaTech | 690632-30-5 | MFCD01631898 | 298.740 | C13H11ClO4S | 95.000 | COc1ccccc1Oc1ccc(cc1)S(Cl)(=O)=O | 5g | 112531343
eMolecules 6175-45-7 | 2,2-Diethoxyacetophenone | Ambeed | MFCD00009659 | 208.257 | C12H16O3 | 97.000 | CCOC(OCC)C(=O)c1ccccc1 | 25g | 632810087
2,2-Diethoxyacetophenone | Ambeed | 6175-45-7 | MFCD00009659 | 208.257 | C12H16O3 | 97.000 | CCOC(OCC)C(=O)c1ccccc1 | 25g | 632810087